C28H31N3O2 — CID 143439374
7-cyclohexyl-6-[4-[(3E,5Z)-7-methylocta-3,5,7-trien-3-yl]phenyl]pyrazolo[1,5-a]pyrimidine-3-carboxylic acid (PubChem CID 143439374) has the molecular formula C28H31N3O2 and a molecular weight of 441.58 g/mol. Its IUPAC name is 7-cyclohexyl-6-[4-[(3E,5Z)-7-methylocta-3,5,7-trien-3-yl]phenyl]pyrazolo[1,5-a]pyrimidine-3-carboxylic acid.
| Compound Name | 7-cyclohexyl-6-[4-[(3E,5Z)-7-methylocta-3,5,7-trien-3-yl]phenyl]pyrazolo[1,5-a]pyrimidine-3-carboxylic acid |
|---|---|
| PubChem CID | 143439374 |
| Molecular Formula | C28H31N3O2 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 7-cyclohexyl-6-[4-[(3E,5Z)-7-methylocta-3,5,7-trien-3-yl]phenyl]pyrazolo[1,5-a]pyrimidine-3-carboxylic acid |
| SMILES | C=C(C)/C=C\C=C(/CC)c1ccc(-c2cnc3c(C(=O)O)cnn3c2C2CCCCC2)cc1 |
| InChI | InChI=1S/C28H31N3O2/c1-4-20(12-8-9-19(2)3)21-13-15-22(16-14-21)24-17-29-27-25(28(32)33)18-30-31(27)26(24)23-10-6-5-7-11-23/h8-9,12-18,23H,2,4-7,10-11H2,1,3H3,(H,32,33)/b9-8-,20-12+ |
| InChIKey | BJXGSLXPTFDVAQ-PSVZDAOJSA-N |
| XLogP | 7.07 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|