About ethane;(3E)-N-ethyl-N-methylhexa-3,5-dien-3-amine
ethane;(3E)-N-ethyl-N-methylhexa-3,5-dien-3-amine (PubChem CID 143439563) has the molecular formula C11H23N
and a molecular weight of 169.31 g/mol. Its IUPAC name is ethane;(3E)-N-ethyl-N-methylhexa-3,5-dien-3-amine.
Molecular Properties
| Compound Name | ethane;(3E)-N-ethyl-N-methylhexa-3,5-dien-3-amine |
| PubChem CID | 143439563 |
| Molecular Formula | C11H23N |
| Molecular Weight | 169.31 g/mol |
| Exact Mass | 169.18 |
| IUPAC Name | ethane;(3E)-N-ethyl-N-methylhexa-3,5-dien-3-amine |
| SMILES | C=C/C=C(\CC)N(C)CC.CC |
| InChI | InChI=1S/C9H17N.C2H6/c1-5-8-9(6-2)10(4)7-3;1-2/h5,8H,1,6-7H2,2-4H3;1-2H3/b9-8+; |
| InChIKey | ARCKOQUENXQNDY-HRNDJLQDSA-N |
| XLogP | 3.44 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(3E)-N-ethyl-N-methylhexa-3,5-dien-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(3E)-N-ethyl-N-methylhexa-3,5-dien-3-amine?
The IUPAC name of ethane;(3E)-N-ethyl-N-methylhexa-3,5-dien-3-amine (CID 143439563) is ethane;(3E)-N-ethyl-N-methylhexa-3,5-dien-3-amine.
What is the SMILES notation for ethane;(3E)-N-ethyl-N-methylhexa-3,5-dien-3-amine?
The canonical SMILES for ethane;(3E)-N-ethyl-N-methylhexa-3,5-dien-3-amine is C=C/C=C(\CC)N(C)CC.CC.
What is the InChIKey of ethane;(3E)-N-ethyl-N-methylhexa-3,5-dien-3-amine?
The InChIKey is ARCKOQUENXQNDY-HRNDJLQDSA-N. The full InChI is InChI=1S/C9H17N.C2H6/c1-5-8-9(6-2)10(4)7-3;1-2/h5,8H,1,6-7H2,2-4H3;1-2H3/b9-8+;.
What are the key properties of ethane;(3E)-N-ethyl-N-methylhexa-3,5-dien-3-amine?
ethane;(3E)-N-ethyl-N-methylhexa-3,5-dien-3-amine has a molecular weight of 169.31 g/mol, XLogP of 3.44, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(3E)-N-ethyl-N-methylhexa-3,5-dien-3-amine is sourced from PubChem (CID 143439563), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).