C16H25N7 — CID 143439959
3-[(E)-1-hydrazinylprop-1-en-2-yl]-6-methyl-5-(1-methylpiperidin-3-yl)pyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 143439959) has the molecular formula C16H25N7 and a molecular weight of 315.43 g/mol. Its IUPAC name is 3-[(E)-1-hydrazinylprop-1-en-2-yl]-6-methyl-5-(1-methylpiperidin-3-yl)pyrazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 3-[(E)-1-hydrazinylprop-1-en-2-yl]-6-methyl-5-(1-methylpiperidin-3-yl)pyrazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 143439959 |
| Molecular Formula | C16H25N7 |
| Molecular Weight | 315.43 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | 3-[(E)-1-hydrazinylprop-1-en-2-yl]-6-methyl-5-(1-methylpiperidin-3-yl)pyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | C/C(=C\NN)c1cnn2c(N)c(C)c(C3CCCN(C)C3)nc12 |
| InChI | InChI=1S/C16H25N7/c1-10(7-19-18)13-8-20-23-15(17)11(2)14(21-16(13)23)12-5-4-6-22(3)9-12/h7-8,12,19H,4-6,9,17-18H2,1-3H3/b10-7+ |
| InChIKey | UTNBVMYNOLOROS-JXMROGBWSA-N |
| XLogP | 1.25 |
| TPSA | 97.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.43 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|