About ethane;3-phenylsulfanyl-5-pyrrolidin-1-ylpyrazolo[1,5-a]pyrimidin-7-amine
ethane;3-phenylsulfanyl-5-pyrrolidin-1-ylpyrazolo[1,5-a]pyrimidin-7-amine (PubChem CID 143440247) has the molecular formula C18H23N5S
and a molecular weight of 341.48 g/mol. Its IUPAC name is ethane;3-phenylsulfanyl-5-pyrrolidin-1-ylpyrazolo[1,5-a]pyrimidin-7-amine.
Molecular Properties
| Compound Name | ethane;3-phenylsulfanyl-5-pyrrolidin-1-ylpyrazolo[1,5-a]pyrimidin-7-amine |
| PubChem CID | 143440247 |
| Molecular Formula | C18H23N5S |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | ethane;3-phenylsulfanyl-5-pyrrolidin-1-ylpyrazolo[1,5-a]pyrimidin-7-amine |
| SMILES | CC.Nc1cc(N2CCCC2)nc2c(Sc3ccccc3)cnn12 |
| InChI | InChI=1S/C16H17N5S.C2H6/c17-14-10-15(20-8-4-5-9-20)19-16-13(11-18-21(14)16)22-12-6-2-1-3-7-12;1-2/h1-3,6-7,10-11H,4-5,8-9,17H2;1-2H3 |
| InChIKey | UESRKGXZKQQPOJ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 59.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethane;3-phenylsulfanyl-5-pyrrolidin-1-ylpyrazolo[1,5-a]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-phenylsulfanyl-5-pyrrolidin-1-ylpyrazolo[1,5-a]pyrimidin-7-amine?
The IUPAC name of ethane;3-phenylsulfanyl-5-pyrrolidin-1-ylpyrazolo[1,5-a]pyrimidin-7-amine (CID 143440247) is ethane;3-phenylsulfanyl-5-pyrrolidin-1-ylpyrazolo[1,5-a]pyrimidin-7-amine.
What is the SMILES notation for ethane;3-phenylsulfanyl-5-pyrrolidin-1-ylpyrazolo[1,5-a]pyrimidin-7-amine?
The canonical SMILES for ethane;3-phenylsulfanyl-5-pyrrolidin-1-ylpyrazolo[1,5-a]pyrimidin-7-amine is CC.Nc1cc(N2CCCC2)nc2c(Sc3ccccc3)cnn12.
What is the InChIKey of ethane;3-phenylsulfanyl-5-pyrrolidin-1-ylpyrazolo[1,5-a]pyrimidin-7-amine?
The InChIKey is UESRKGXZKQQPOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N5S.C2H6/c17-14-10-15(20-8-4-5-9-20)19-16-13(11-18-21(14)16)22-12-6-2-1-3-7-12;1-2/h1-3,6-7,10-11H,4-5,8-9,17H2;1-2H3.
What are the key properties of ethane;3-phenylsulfanyl-5-pyrrolidin-1-ylpyrazolo[1,5-a]pyrimidin-7-amine?
ethane;3-phenylsulfanyl-5-pyrrolidin-1-ylpyrazolo[1,5-a]pyrimidin-7-amine has a molecular weight of 341.48 g/mol, XLogP of 4.09, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-phenylsulfanyl-5-pyrrolidin-1-ylpyrazolo[1,5-a]pyrimidin-7-amine is sourced from PubChem (CID 143440247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).