C16H26N2O — CID 143440668
(3Z,5Z)-6-methyl-10-[2-(methylamino)ethylamino]-7-methylideneundeca-1,3,5,8-tetraen-5-ol (PubChem CID 143440668) has the molecular formula C16H26N2O and a molecular weight of 262.40 g/mol. Its IUPAC name is (3Z,5Z)-6-methyl-10-[2-(methylamino)ethylamino]-7-methylideneundeca-1,3,5,8-tetraen-5-ol.
| Compound Name | (3Z,5Z)-6-methyl-10-[2-(methylamino)ethylamino]-7-methylideneundeca-1,3,5,8-tetraen-5-ol |
|---|---|
| PubChem CID | 143440668 |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.20 |
| IUPAC Name | (3Z,5Z)-6-methyl-10-[2-(methylamino)ethylamino]-7-methylideneundeca-1,3,5,8-tetraen-5-ol |
| SMILES | C=C/C=C\C(O)=C(/C)C(=C)C=CC(C)NCCNC |
| InChI | InChI=1S/C16H26N2O/c1-6-7-8-16(19)15(4)13(2)9-10-14(3)18-12-11-17-5/h6-10,14,17-19H,1-2,11-12H2,3-5H3/b8-7-,10-9?,16-15- |
| InChIKey | LEKHDNUFLJKNQH-UFFAPEDPSA-N |
| XLogP | 2.87 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|