About 7-chloro-2,6-dimethyl-5H-pyrazolo[1,5-b][1,2,4]triazole
7-chloro-2,6-dimethyl-5H-pyrazolo[1,5-b][1,2,4]triazole (PubChem CID 14344180) has the molecular formula C6H7ClN4
and a molecular weight of 170.60 g/mol. Its IUPAC name is 7-chloro-2,6-dimethyl-5H-pyrazolo[1,5-b][1,2,4]triazole.
Analyze 7-chloro-2,6-dimethyl-5H-pyrazolo[1,5-b][1,2,4]triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2,6-dimethyl-5H-pyrazolo[1,5-b][1,2,4]triazole?
The IUPAC name of 7-chloro-2,6-dimethyl-5H-pyrazolo[1,5-b][1,2,4]triazole (CID 14344180) is 7-chloro-2,6-dimethyl-5H-pyrazolo[1,5-b][1,2,4]triazole.
What is the SMILES notation for 7-chloro-2,6-dimethyl-5H-pyrazolo[1,5-b][1,2,4]triazole?
The canonical SMILES for 7-chloro-2,6-dimethyl-5H-pyrazolo[1,5-b][1,2,4]triazole is Cc1nc2c(Cl)c(C)[nH]n2n1.
What is the InChIKey of 7-chloro-2,6-dimethyl-5H-pyrazolo[1,5-b][1,2,4]triazole?
The InChIKey is NIJMWACJAMCRMF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClN4/c1-3-5(7)6-8-4(2)10-11(6)9-3/h9H,1-2H3.
What are the key properties of 7-chloro-2,6-dimethyl-5H-pyrazolo[1,5-b][1,2,4]triazole?
7-chloro-2,6-dimethyl-5H-pyrazolo[1,5-b][1,2,4]triazole has a molecular weight of 170.60 g/mol, XLogP of 1.33, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2,6-dimethyl-5H-pyrazolo[1,5-b][1,2,4]triazole is sourced from PubChem (CID 14344180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).