C17H19BrClN5 — CID 143441990
N'-[3-bromo-5-(2-chlorocyclohepta-1,3,5-trien-1-yl)-6H-pyrazolo[1,5-a][1,3]diazepin-8-yl]-N-methylethane-1,2-diamine (PubChem CID 143441990) has the molecular formula C17H19BrClN5 and a molecular weight of 408.73 g/mol. Its IUPAC name is N'-[3-bromo-5-(2-chlorocyclohepta-1,3,5-trien-1-yl)-6H-pyrazolo[1,5-a][1,3]diazepin-8-yl]-N-methylethane-1,2-diamine.
| Compound Name | N'-[3-bromo-5-(2-chlorocyclohepta-1,3,5-trien-1-yl)-6H-pyrazolo[1,5-a][1,3]diazepin-8-yl]-N-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 143441990 |
| Molecular Formula | C17H19BrClN5 |
| Molecular Weight | 408.73 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | N'-[3-bromo-5-(2-chlorocyclohepta-1,3,5-trien-1-yl)-6H-pyrazolo[1,5-a][1,3]diazepin-8-yl]-N-methylethane-1,2-diamine |
| SMILES | CNCCNC1=CCC(C2=C(Cl)C=CC=CC2)=Nc2c(Br)cnn21 |
| InChI | InChI=1S/C17H19BrClN5/c1-20-9-10-21-16-8-7-15(12-5-3-2-4-6-14(12)19)23-17-13(18)11-22-24(16)17/h2-4,6,8,11,20-21H,5,7,9-10H2,1H3 |
| InChIKey | RHQCGTJDVGVBFT-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 54.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.73 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|