About 2-[amino(butyl)amino]cyclohexa-1,3-dien-1-amine;ethane
2-[amino(butyl)amino]cyclohexa-1,3-dien-1-amine;ethane (PubChem CID 143443419) has the molecular formula C12H25N3
and a molecular weight of 211.35 g/mol. Its IUPAC name is 2-[amino(butyl)amino]cyclohexa-1,3-dien-1-amine;ethane.
Molecular Properties
| Compound Name | 2-[amino(butyl)amino]cyclohexa-1,3-dien-1-amine;ethane |
| PubChem CID | 143443419 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | 2-[amino(butyl)amino]cyclohexa-1,3-dien-1-amine;ethane |
| SMILES | CC.CCCCN(N)C1=C(N)CCC=C1 |
| InChI | InChI=1S/C10H19N3.C2H6/c1-2-3-8-13(12)10-7-5-4-6-9(10)11;1-2/h5,7H,2-4,6,8,11-12H2,1H3;1-2H3 |
| InChIKey | RMRNRWBAYUSVBA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[amino(butyl)amino]cyclohexa-1,3-dien-1-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[amino(butyl)amino]cyclohexa-1,3-dien-1-amine;ethane?
The IUPAC name of 2-[amino(butyl)amino]cyclohexa-1,3-dien-1-amine;ethane (CID 143443419) is 2-[amino(butyl)amino]cyclohexa-1,3-dien-1-amine;ethane.
What is the SMILES notation for 2-[amino(butyl)amino]cyclohexa-1,3-dien-1-amine;ethane?
The canonical SMILES for 2-[amino(butyl)amino]cyclohexa-1,3-dien-1-amine;ethane is CC.CCCCN(N)C1=C(N)CCC=C1.
What is the InChIKey of 2-[amino(butyl)amino]cyclohexa-1,3-dien-1-amine;ethane?
The InChIKey is RMRNRWBAYUSVBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3.C2H6/c1-2-3-8-13(12)10-7-5-4-6-9(10)11;1-2/h5,7H,2-4,6,8,11-12H2,1H3;1-2H3.
What are the key properties of 2-[amino(butyl)amino]cyclohexa-1,3-dien-1-amine;ethane?
2-[amino(butyl)amino]cyclohexa-1,3-dien-1-amine;ethane has a molecular weight of 211.35 g/mol, XLogP of 2.51, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[amino(butyl)amino]cyclohexa-1,3-dien-1-amine;ethane is sourced from PubChem (CID 143443419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).