C14H29N3O2 — CID 143443518
N-[(Z)-5-aminopent-4-enyl]-N-methylmorpholine-4-carboxamide;propane (PubChem CID 143443518) has the molecular formula C14H29N3O2 and a molecular weight of 271.40 g/mol. Its IUPAC name is N-[(Z)-5-aminopent-4-enyl]-N-methylmorpholine-4-carboxamide;propane.
| Compound Name | N-[(Z)-5-aminopent-4-enyl]-N-methylmorpholine-4-carboxamide;propane |
|---|---|
| PubChem CID | 143443518 |
| Molecular Formula | C14H29N3O2 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | N-[(Z)-5-aminopent-4-enyl]-N-methylmorpholine-4-carboxamide;propane |
| SMILES | CCC.CN(CCC/C=C\N)C(=O)N1CCOCC1 |
| InChI | InChI=1S/C11H21N3O2.C3H8/c1-13(6-4-2-3-5-12)11(15)14-7-9-16-10-8-14;1-3-2/h3,5H,2,4,6-10,12H2,1H3;3H2,1-2H3/b5-3-; |
| InChIKey | TVHWUIJXKBTLHP-FBZPGIPVSA-N |
| XLogP | 2.04 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|