About ethane;2-methyldodec-1-en-3-one
ethane;2-methyldodec-1-en-3-one (PubChem CID 143443601) has the molecular formula C15H30O
and a molecular weight of 226.40 g/mol. Its IUPAC name is ethane;2-methyldodec-1-en-3-one.
Molecular Properties
| Compound Name | ethane;2-methyldodec-1-en-3-one |
| PubChem CID | 143443601 |
| Molecular Formula | C15H30O |
| Molecular Weight | 226.40 g/mol |
| Exact Mass | 226.23 |
| IUPAC Name | ethane;2-methyldodec-1-en-3-one |
| SMILES | C=C(C)C(=O)CCCCCCCCC.CC |
| InChI | InChI=1S/C13H24O.C2H6/c1-4-5-6-7-8-9-10-11-13(14)12(2)3;1-2/h2,4-11H2,1,3H3;1-2H3 |
| InChIKey | ZNUMCPXIRGXHNF-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 226.40 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methyldodec-1-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methyldodec-1-en-3-one?
The IUPAC name of ethane;2-methyldodec-1-en-3-one (CID 143443601) is ethane;2-methyldodec-1-en-3-one.
What is the SMILES notation for ethane;2-methyldodec-1-en-3-one?
The canonical SMILES for ethane;2-methyldodec-1-en-3-one is C=C(C)C(=O)CCCCCCCCC.CC.
What is the InChIKey of ethane;2-methyldodec-1-en-3-one?
The InChIKey is ZNUMCPXIRGXHNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O.C2H6/c1-4-5-6-7-8-9-10-11-13(14)12(2)3;1-2/h2,4-11H2,1,3H3;1-2H3.
What are the key properties of ethane;2-methyldodec-1-en-3-one?
ethane;2-methyldodec-1-en-3-one has a molecular weight of 226.40 g/mol, XLogP of 5.30, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methyldodec-1-en-3-one is sourced from PubChem (CID 143443601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).