C17H18N4O — CID 143443807
1-(2-amino-4-cyanophenyl)-3-[(2,6-dimethylphenyl)methyl]urea (PubChem CID 143443807) has the molecular formula C17H18N4O and a molecular weight of 294.36 g/mol. Its IUPAC name is 1-(2-amino-4-cyanophenyl)-3-[(2,6-dimethylphenyl)methyl]urea.
| Compound Name | 1-(2-amino-4-cyanophenyl)-3-[(2,6-dimethylphenyl)methyl]urea |
|---|---|
| PubChem CID | 143443807 |
| Molecular Formula | C17H18N4O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 1-(2-amino-4-cyanophenyl)-3-[(2,6-dimethylphenyl)methyl]urea |
| SMILES | Cc1cccc(C)c1CNC(=O)Nc1ccc(C#N)cc1N |
| InChI | InChI=1S/C17H18N4O/c1-11-4-3-5-12(2)14(11)10-20-17(22)21-16-7-6-13(9-18)8-15(16)19/h3-8H,10,19H2,1-2H3,(H2,20,21,22) |
| InChIKey | JIVBZTJXFZSXAW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|