C16H26N2 — CID 143443978
ethane;4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1-methylpiperidine-4-carbonitrile (PubChem CID 143443978) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is ethane;4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1-methylpiperidine-4-carbonitrile.
| Compound Name | ethane;4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1-methylpiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 143443978 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | ethane;4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-1-methylpiperidine-4-carbonitrile |
| SMILES | C=C/C(=C\C=C/C)C1(C#N)CCN(C)CC1.CC |
| InChI | InChI=1S/C14H20N2.C2H6/c1-4-6-7-13(5-2)14(12-15)8-10-16(3)11-9-14;1-2/h4-7H,2,8-11H2,1,3H3;1-2H3/b6-4-,13-7+; |
| InChIKey | MYGLFDYAKIJYFH-ZJPWNLOHSA-N |
| XLogP | 3.94 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|