C22H34 — CID 143444546
1-methyl-3-[4-(4-propylcyclohexyl)cyclohexyl]benzene (PubChem CID 143444546) has the molecular formula C22H34 and a molecular weight of 298.51 g/mol. Its IUPAC name is 1-methyl-3-[4-(4-propylcyclohexyl)cyclohexyl]benzene.
| Compound Name | 1-methyl-3-[4-(4-propylcyclohexyl)cyclohexyl]benzene |
|---|---|
| PubChem CID | 143444546 |
| Molecular Formula | C22H34 |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | 1-methyl-3-[4-(4-propylcyclohexyl)cyclohexyl]benzene |
| SMILES | CCCC1CCC(C2CCC(c3cccc(C)c3)CC2)CC1 |
| InChI | InChI=1S/C22H34/c1-3-5-18-8-10-19(11-9-18)20-12-14-21(15-13-20)22-7-4-6-17(2)16-22/h4,6-7,16,18-21H,3,5,8-15H2,1-2H3 |
| InChIKey | VMOVDABOACUXBD-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |