C15H18N2O3 — CID 143445254
2-(1-methoxy-3-bicyclo[4.1.0]hepta-2,4-dienyl)-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione (PubChem CID 143445254) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-(1-methoxy-3-bicyclo[4.1.0]hepta-2,4-dienyl)-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione.
| Compound Name | 2-(1-methoxy-3-bicyclo[4.1.0]hepta-2,4-dienyl)-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione |
|---|---|
| PubChem CID | 143445254 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 2-(1-methoxy-3-bicyclo[4.1.0]hepta-2,4-dienyl)-6,7,8,8a-tetrahydro-5H-imidazo[1,5-a]pyridine-1,3-dione |
| SMILES | COC12C=C(N3C(=O)C4CCCCN4C3=O)C=CC1C2 |
| InChI | InChI=1S/C15H18N2O3/c1-20-15-8-10(15)5-6-11(9-15)17-13(18)12-4-2-3-7-16(12)14(17)19/h5-6,9-10,12H,2-4,7-8H2,1H3 |
| InChIKey | RZOHMFFMMHOHOI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|