About 2-(benzotriazol-1-yl)-4,6-ditert-butylphenol
2-(benzotriazol-1-yl)-4,6-ditert-butylphenol (PubChem CID 14344570) has the molecular formula C20H25N3O
and a molecular weight of 323.44 g/mol. Its IUPAC name is 2-(benzotriazol-1-yl)-4,6-ditert-butylphenol.
Molecular Properties
| Compound Name | 2-(benzotriazol-1-yl)-4,6-ditert-butylphenol |
| PubChem CID | 14344570 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | 2-(benzotriazol-1-yl)-4,6-ditert-butylphenol |
| SMILES | CC(C)(C)c1cc(-n2nnc3ccccc32)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C20H25N3O/c1-19(2,3)13-11-14(20(4,5)6)18(24)17(12-13)23-16-10-8-7-9-15(16)21-22-23/h7-12,24H,1-6H3 |
| InChIKey | MAUPWFUGNWVBSU-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(benzotriazol-1-yl)-4,6-ditert-butylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(benzotriazol-1-yl)-4,6-ditert-butylphenol?
The IUPAC name of 2-(benzotriazol-1-yl)-4,6-ditert-butylphenol (CID 14344570) is 2-(benzotriazol-1-yl)-4,6-ditert-butylphenol.
What is the SMILES notation for 2-(benzotriazol-1-yl)-4,6-ditert-butylphenol?
The canonical SMILES for 2-(benzotriazol-1-yl)-4,6-ditert-butylphenol is CC(C)(C)c1cc(-n2nnc3ccccc32)c(O)c(C(C)(C)C)c1.
What is the InChIKey of 2-(benzotriazol-1-yl)-4,6-ditert-butylphenol?
The InChIKey is MAUPWFUGNWVBSU-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N3O/c1-19(2,3)13-11-14(20(4,5)6)18(24)17(12-13)23-16-10-8-7-9-15(16)21-22-23/h7-12,24H,1-6H3.
What are the key properties of 2-(benzotriazol-1-yl)-4,6-ditert-butylphenol?
2-(benzotriazol-1-yl)-4,6-ditert-butylphenol has a molecular weight of 323.44 g/mol, XLogP of 4.72, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(benzotriazol-1-yl)-4,6-ditert-butylphenol is sourced from PubChem (CID 14344570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).