About 2,4-difluoro-1-(3-methylidenecyclopentyl)benzene;ethane;formic acid
2,4-difluoro-1-(3-methylidenecyclopentyl)benzene;ethane;formic acid (PubChem CID 143445784) has the molecular formula C15H20F2O2
and a molecular weight of 270.32 g/mol. Its IUPAC name is 2,4-difluoro-1-(3-methylidenecyclopentyl)benzene;ethane;formic acid.
Molecular Properties
| Compound Name | 2,4-difluoro-1-(3-methylidenecyclopentyl)benzene;ethane;formic acid |
| PubChem CID | 143445784 |
| Molecular Formula | C15H20F2O2 |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 2,4-difluoro-1-(3-methylidenecyclopentyl)benzene;ethane;formic acid |
| SMILES | C=C1CCC(c2ccc(F)cc2F)C1.CC.O=CO |
| InChI | InChI=1S/C12H12F2.C2H6.CH2O2/c1-8-2-3-9(6-8)11-5-4-10(13)7-12(11)14;1-2;2-1-3/h4-5,7,9H,1-3,6H2;1-2H3;1H,(H,2,3) |
| InChIKey | YKTNUXKOOATWBE-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,4-difluoro-1-(3-methylidenecyclopentyl)benzene;ethane;formic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-difluoro-1-(3-methylidenecyclopentyl)benzene;ethane;formic acid?
The IUPAC name of 2,4-difluoro-1-(3-methylidenecyclopentyl)benzene;ethane;formic acid (CID 143445784) is 2,4-difluoro-1-(3-methylidenecyclopentyl)benzene;ethane;formic acid.
What is the SMILES notation for 2,4-difluoro-1-(3-methylidenecyclopentyl)benzene;ethane;formic acid?
The canonical SMILES for 2,4-difluoro-1-(3-methylidenecyclopentyl)benzene;ethane;formic acid is C=C1CCC(c2ccc(F)cc2F)C1.CC.O=CO.
What is the InChIKey of 2,4-difluoro-1-(3-methylidenecyclopentyl)benzene;ethane;formic acid?
The InChIKey is YKTNUXKOOATWBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12F2.C2H6.CH2O2/c1-8-2-3-9(6-8)11-5-4-10(13)7-12(11)14;1-2;2-1-3/h4-5,7,9H,1-3,6H2;1-2H3;1H,(H,2,3).
What are the key properties of 2,4-difluoro-1-(3-methylidenecyclopentyl)benzene;ethane;formic acid?
2,4-difluoro-1-(3-methylidenecyclopentyl)benzene;ethane;formic acid has a molecular weight of 270.32 g/mol, XLogP of 4.52, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-difluoro-1-(3-methylidenecyclopentyl)benzene;ethane;formic acid is sourced from PubChem (CID 143445784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).