C30H30N4O2S — CID 143446004
acetylene;2,3-dimethyl-5-pyridin-2-yl-1,4-benzothiazepine;N'-(2-methylbut-3-enoyl)benzohydrazide (PubChem CID 143446004) has the molecular formula C30H30N4O2S and a molecular weight of 510.66 g/mol. Its IUPAC name is acetylene;2,3-dimethyl-5-pyridin-2-yl-1,4-benzothiazepine;N'-(2-methylbut-3-enoyl)benzohydrazide.
| Compound Name | acetylene;2,3-dimethyl-5-pyridin-2-yl-1,4-benzothiazepine;N'-(2-methylbut-3-enoyl)benzohydrazide |
|---|---|
| PubChem CID | 143446004 |
| Molecular Formula | C30H30N4O2S |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.21 |
| IUPAC Name | acetylene;2,3-dimethyl-5-pyridin-2-yl-1,4-benzothiazepine;N'-(2-methylbut-3-enoyl)benzohydrazide |
| SMILES | C#C.C=CC(C)C(=O)NNC(=O)c1ccccc1.CC1=C(C)Sc2ccccc2C(c2ccccn2)=N1 |
| InChI | InChI=1S/C16H14N2S.C12H14N2O2.C2H2/c1-11-12(2)19-15-9-4-3-7-13(15)16(18-11)14-8-5-6-10-17-14;1-3-9(2)11(15)13-14-12(16)10-7-5-4-6-8-10;1-2/h3-10H,1-2H3;3-9H,1H2,2H3,(H,13,15)(H,14,16);1-2H |
| InChIKey | YRCBELVBUDIKIA-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|