C11H18N2O2 — CID 143446170
(Z)-N-(2-oxoazepan-3-yl)pent-3-enamide (PubChem CID 143446170) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is (Z)-N-(2-oxoazepan-3-yl)pent-3-enamide.
| Compound Name | (Z)-N-(2-oxoazepan-3-yl)pent-3-enamide |
|---|---|
| PubChem CID | 143446170 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | (Z)-N-(2-oxoazepan-3-yl)pent-3-enamide |
| SMILES | C/C=C\CC(=O)NC1CCCCNC1=O |
| InChI | InChI=1S/C11H18N2O2/c1-2-3-7-10(14)13-9-6-4-5-8-12-11(9)15/h2-3,9H,4-8H2,1H3,(H,12,15)(H,13,14)/b3-2- |
| InChIKey | QNMKTKZDXBAWJN-IHWYPQMZSA-N |
| XLogP | 0.74 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|