C21H13ClFNOS — CID 143446465
9-(4-chloro-2-fluorophenyl)-2-thia-10-azatricyclo[9.5.0.03,8]hexadeca-1(11),3,5,7,9,12,14-heptaene-13-carbaldehyde (PubChem CID 143446465) has the molecular formula C21H13ClFNOS and a molecular weight of 381.86 g/mol. Its IUPAC name is 9-(4-chloro-2-fluorophenyl)-2-thia-10-azatricyclo[9.5.0.03,8]hexadeca-1(11),3,5,7,9,12,14-heptaene-13-carbaldehyde.
| Compound Name | 9-(4-chloro-2-fluorophenyl)-2-thia-10-azatricyclo[9.5.0.03,8]hexadeca-1(11),3,5,7,9,12,14-heptaene-13-carbaldehyde |
|---|---|
| PubChem CID | 143446465 |
| Molecular Formula | C21H13ClFNOS |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | 9-(4-chloro-2-fluorophenyl)-2-thia-10-azatricyclo[9.5.0.03,8]hexadeca-1(11),3,5,7,9,12,14-heptaene-13-carbaldehyde |
| SMILES | O=CC1=CC2=C(CC=C1)Sc1ccccc1C(c1ccc(Cl)cc1F)=N2 |
| InChI | InChI=1S/C21H13ClFNOS/c22-14-8-9-15(17(23)11-14)21-16-5-1-2-6-19(16)26-20-7-3-4-13(12-25)10-18(20)24-21/h1-6,8-12H,7H2 |
| InChIKey | DBQYRETVZBUXPU-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|