C59H77BN2 — CID 14344695
butyl(triphenyl)boranuide;(2Z)-1-heptyl-2-[(E)-3-(1-heptyl-3,3-dimethylindol-1-ium-2-yl)prop-2-enylidene]-3,3-dimethylindole (PubChem CID 14344695) has the molecular formula C59H77BN2 and a molecular weight of 825.09 g/mol. Its IUPAC name is butyl(triphenyl)boranuide;(2Z)-1-heptyl-2-[(E)-3-(1-heptyl-3,3-dimethylindol-1-ium-2-yl)prop-2-enylidene]-3,3-dimethylindole.
| Compound Name | butyl(triphenyl)boranuide;(2Z)-1-heptyl-2-[(E)-3-(1-heptyl-3,3-dimethylindol-1-ium-2-yl)prop-2-enylidene]-3,3-dimethylindole |
|---|---|
| PubChem CID | 14344695 |
| Molecular Formula | C59H77BN2 |
| Molecular Weight | 825.09 g/mol |
| Exact Mass | 824.62 |
| IUPAC Name | butyl(triphenyl)boranuide;(2Z)-1-heptyl-2-[(E)-3-(1-heptyl-3,3-dimethylindol-1-ium-2-yl)prop-2-enylidene]-3,3-dimethylindole |
| SMILES | CCCCCCCN1/C(=C\C=C\C2=[N+](CCCCCCC)c3ccccc3C2(C)C)C(C)(C)c2ccccc21.CCCC[B-](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C37H53N2.C22H24B/c1-7-9-11-13-19-28-38-32-24-17-15-22-30(32)36(3,4)34(38)26-21-27-35-37(5,6)31-23-16-18-25-33(31)39(35)29-20-14-12-10-8-2;1-2-3-19-23(20-13-7-4-8-14-20,21-15-9-5-10-16-21)22-17-11-6-12-18-22/h15-18,21-27H,7-14,19-20,28-29H2,1-6H3;4-18H,2-3,19H2,1H3/q+1;-1 |
| InChIKey | XZEXJMXJPWRHPM-UHFFFAOYSA-N |
| XLogP | 14.20 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.09 |
| LogP ≤ 5 | 14.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|