About N'-benzyl-6-(4-fluorophenyl)-3,4-dihydrobenzo[b][1,4]benzothiazepine-3-carbohydrazide
N'-benzyl-6-(4-fluorophenyl)-3,4-dihydrobenzo[b][1,4]benzothiazepine-3-carbohydrazide (PubChem CID 143447130) has the molecular formula C27H22FN3OS
and a molecular weight of 455.56 g/mol. Its IUPAC name is N'-benzyl-6-(4-fluorophenyl)-3,4-dihydrobenzo[b][1,4]benzothiazepine-3-carbohydrazide.
Molecular Properties
| Compound Name | N'-benzyl-6-(4-fluorophenyl)-3,4-dihydrobenzo[b][1,4]benzothiazepine-3-carbohydrazide |
| PubChem CID | 143447130 |
| Molecular Formula | C27H22FN3OS |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.15 |
| IUPAC Name | N'-benzyl-6-(4-fluorophenyl)-3,4-dihydrobenzo[b][1,4]benzothiazepine-3-carbohydrazide |
| SMILES | O=C(NNCc1ccccc1)C1C=CC2=C(C1)N=C(c1ccc(F)cc1)c1ccccc1S2 |
| InChI | InChI=1S/C27H22FN3OS/c28-21-13-10-19(11-14-21)26-22-8-4-5-9-24(22)33-25-15-12-20(16-23(25)30-26)27(32)31-29-17-18-6-2-1-3-7-18/h1-15,20,29H,16-17H2,(H,31,32) |
| InChIKey | HXHSBPIQDCKEJS-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-benzyl-6-(4-fluorophenyl)-3,4-dihydrobenzo[b][1,4]benzothiazepine-3-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-benzyl-6-(4-fluorophenyl)-3,4-dihydrobenzo[b][1,4]benzothiazepine-3-carbohydrazide?
The IUPAC name of N'-benzyl-6-(4-fluorophenyl)-3,4-dihydrobenzo[b][1,4]benzothiazepine-3-carbohydrazide (CID 143447130) is N'-benzyl-6-(4-fluorophenyl)-3,4-dihydrobenzo[b][1,4]benzothiazepine-3-carbohydrazide.
What is the SMILES notation for N'-benzyl-6-(4-fluorophenyl)-3,4-dihydrobenzo[b][1,4]benzothiazepine-3-carbohydrazide?
The canonical SMILES for N'-benzyl-6-(4-fluorophenyl)-3,4-dihydrobenzo[b][1,4]benzothiazepine-3-carbohydrazide is O=C(NNCc1ccccc1)C1C=CC2=C(C1)N=C(c1ccc(F)cc1)c1ccccc1S2.
What is the InChIKey of N'-benzyl-6-(4-fluorophenyl)-3,4-dihydrobenzo[b][1,4]benzothiazepine-3-carbohydrazide?
The InChIKey is HXHSBPIQDCKEJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H22FN3OS/c28-21-13-10-19(11-14-21)26-22-8-4-5-9-24(22)33-25-15-12-20(16-23(25)30-26)27(32)31-29-17-18-6-2-1-3-7-18/h1-15,20,29H,16-17H2,(H,31,32).
What are the key properties of N'-benzyl-6-(4-fluorophenyl)-3,4-dihydrobenzo[b][1,4]benzothiazepine-3-carbohydrazide?
N'-benzyl-6-(4-fluorophenyl)-3,4-dihydrobenzo[b][1,4]benzothiazepine-3-carbohydrazide has a molecular weight of 455.56 g/mol, XLogP of 5.38, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-benzyl-6-(4-fluorophenyl)-3,4-dihydrobenzo[b][1,4]benzothiazepine-3-carbohydrazide is sourced from PubChem (CID 143447130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).