C16H25NO — CID 143447260
(3R)-1,3-dimethyl-4-(3-propoxyphenyl)piperidine (PubChem CID 143447260) has the molecular formula C16H25NO and a molecular weight of 247.38 g/mol. Its IUPAC name is (3R)-1,3-dimethyl-4-(3-propoxyphenyl)piperidine.
| Compound Name | (3R)-1,3-dimethyl-4-(3-propoxyphenyl)piperidine |
|---|---|
| PubChem CID | 143447260 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | (3R)-1,3-dimethyl-4-(3-propoxyphenyl)piperidine |
| SMILES | CCCOc1cccc(C2CCN(C)C[C@@H]2C)c1 |
| InChI | InChI=1S/C16H25NO/c1-4-10-18-15-7-5-6-14(11-15)16-8-9-17(3)12-13(16)2/h5-7,11,13,16H,4,8-10,12H2,1-3H3/t13-,16?/m0/s1 |
| InChIKey | HQCDKUGBQLVELG-KNVGNIICSA-N |
| XLogP | 3.53 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |