C13H20F3NO — CID 143447833
ethane;N-[(3Z)-3-ethenylhexa-3,5-dienyl]-2,2,2-trifluoro-N-methylacetamide (PubChem CID 143447833) has the molecular formula C13H20F3NO and a molecular weight of 263.30 g/mol. Its IUPAC name is ethane;N-[(3Z)-3-ethenylhexa-3,5-dienyl]-2,2,2-trifluoro-N-methylacetamide.
| Compound Name | ethane;N-[(3Z)-3-ethenylhexa-3,5-dienyl]-2,2,2-trifluoro-N-methylacetamide |
|---|---|
| PubChem CID | 143447833 |
| Molecular Formula | C13H20F3NO |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | ethane;N-[(3Z)-3-ethenylhexa-3,5-dienyl]-2,2,2-trifluoro-N-methylacetamide |
| SMILES | C=C/C=C(\C=C)CCN(C)C(=O)C(F)(F)F.CC |
| InChI | InChI=1S/C11H14F3NO.C2H6/c1-4-6-9(5-2)7-8-15(3)10(16)11(12,13)14;1-2/h4-6H,1-2,7-8H2,3H3;1-2H3/b9-6+; |
| InChIKey | HEHHRYGSOVLCTN-MLBSPLJJSA-N |
| XLogP | 3.72 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|