About 4,6-di(propan-2-yl)-2,3-dihydro-1H-indole
4,6-di(propan-2-yl)-2,3-dihydro-1H-indole (PubChem CID 14344795) has the molecular formula C14H21N
and a molecular weight of 203.33 g/mol. Its IUPAC name is 4,6-di(propan-2-yl)-2,3-dihydro-1H-indole.
Molecular Properties
| Compound Name | 4,6-di(propan-2-yl)-2,3-dihydro-1H-indole |
| PubChem CID | 14344795 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 4,6-di(propan-2-yl)-2,3-dihydro-1H-indole |
| SMILES | CC(C)c1cc2c(c(C(C)C)c1)CCN2 |
| InChI | InChI=1S/C14H21N/c1-9(2)11-7-13(10(3)4)12-5-6-15-14(12)8-11/h7-10,15H,5-6H2,1-4H3 |
| InChIKey | KCFNVSDOFPZTER-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,6-di(propan-2-yl)-2,3-dihydro-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-di(propan-2-yl)-2,3-dihydro-1H-indole?
The IUPAC name of 4,6-di(propan-2-yl)-2,3-dihydro-1H-indole (CID 14344795) is 4,6-di(propan-2-yl)-2,3-dihydro-1H-indole.
What is the SMILES notation for 4,6-di(propan-2-yl)-2,3-dihydro-1H-indole?
The canonical SMILES for 4,6-di(propan-2-yl)-2,3-dihydro-1H-indole is CC(C)c1cc2c(c(C(C)C)c1)CCN2.
What is the InChIKey of 4,6-di(propan-2-yl)-2,3-dihydro-1H-indole?
The InChIKey is KCFNVSDOFPZTER-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N/c1-9(2)11-7-13(10(3)4)12-5-6-15-14(12)8-11/h7-10,15H,5-6H2,1-4H3.
What are the key properties of 4,6-di(propan-2-yl)-2,3-dihydro-1H-indole?
4,6-di(propan-2-yl)-2,3-dihydro-1H-indole has a molecular weight of 203.33 g/mol, XLogP of 3.90, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-di(propan-2-yl)-2,3-dihydro-1H-indole is sourced from PubChem (CID 14344795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).