About 5-fluoro-2-[(E)-3-[(2R)-oxolan-2-yl]prop-2-enyl]sulfonyl-1,3-dihydroisoindole
5-fluoro-2-[(E)-3-[(2R)-oxolan-2-yl]prop-2-enyl]sulfonyl-1,3-dihydroisoindole (PubChem CID 143448060) has the molecular formula C15H18FNO3S
and a molecular weight of 311.38 g/mol. Its IUPAC name is 5-fluoro-2-[(E)-3-[(2R)-oxolan-2-yl]prop-2-enyl]sulfonyl-1,3-dihydroisoindole.
Molecular Properties
| Compound Name | 5-fluoro-2-[(E)-3-[(2R)-oxolan-2-yl]prop-2-enyl]sulfonyl-1,3-dihydroisoindole |
| PubChem CID | 143448060 |
| Molecular Formula | C15H18FNO3S |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 5-fluoro-2-[(E)-3-[(2R)-oxolan-2-yl]prop-2-enyl]sulfonyl-1,3-dihydroisoindole |
| SMILES | O=S(=O)(C/C=C/[C@H]1CCCO1)N1Cc2ccc(F)cc2C1 |
| InChI | InChI=1S/C15H18FNO3S/c16-14-6-5-12-10-17(11-13(12)9-14)21(18,19)8-2-4-15-3-1-7-20-15/h2,4-6,9,15H,1,3,7-8,10-11H2/b4-2+/t15-/m1/s1 |
| InChIKey | LXGFCKGDTJMZNC-TXTHVTMNSA-N |
| XLogP | 2.21 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-fluoro-2-[(E)-3-[(2R)-oxolan-2-yl]prop-2-enyl]sulfonyl-1,3-dihydroisoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-2-[(E)-3-[(2R)-oxolan-2-yl]prop-2-enyl]sulfonyl-1,3-dihydroisoindole?
The IUPAC name of 5-fluoro-2-[(E)-3-[(2R)-oxolan-2-yl]prop-2-enyl]sulfonyl-1,3-dihydroisoindole (CID 143448060) is 5-fluoro-2-[(E)-3-[(2R)-oxolan-2-yl]prop-2-enyl]sulfonyl-1,3-dihydroisoindole.
What is the SMILES notation for 5-fluoro-2-[(E)-3-[(2R)-oxolan-2-yl]prop-2-enyl]sulfonyl-1,3-dihydroisoindole?
The canonical SMILES for 5-fluoro-2-[(E)-3-[(2R)-oxolan-2-yl]prop-2-enyl]sulfonyl-1,3-dihydroisoindole is O=S(=O)(C/C=C/[C@H]1CCCO1)N1Cc2ccc(F)cc2C1.
What is the InChIKey of 5-fluoro-2-[(E)-3-[(2R)-oxolan-2-yl]prop-2-enyl]sulfonyl-1,3-dihydroisoindole?
The InChIKey is LXGFCKGDTJMZNC-TXTHVTMNSA-N. The full InChI is InChI=1S/C15H18FNO3S/c16-14-6-5-12-10-17(11-13(12)9-14)21(18,19)8-2-4-15-3-1-7-20-15/h2,4-6,9,15H,1,3,7-8,10-11H2/b4-2+/t15-/m1/s1.
What are the key properties of 5-fluoro-2-[(E)-3-[(2R)-oxolan-2-yl]prop-2-enyl]sulfonyl-1,3-dihydroisoindole?
5-fluoro-2-[(E)-3-[(2R)-oxolan-2-yl]prop-2-enyl]sulfonyl-1,3-dihydroisoindole has a molecular weight of 311.38 g/mol, XLogP of 2.21, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-2-[(E)-3-[(2R)-oxolan-2-yl]prop-2-enyl]sulfonyl-1,3-dihydroisoindole is sourced from PubChem (CID 143448060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).