About (2E,3Z)-2,3-di(ethylidene)quinolin-4-amine;ethane
(2E,3Z)-2,3-di(ethylidene)quinolin-4-amine;ethane (PubChem CID 143448246) has the molecular formula C17H26N2
and a molecular weight of 258.41 g/mol. Its IUPAC name is (2E,3Z)-2,3-di(ethylidene)quinolin-4-amine;ethane.
Molecular Properties
| Compound Name | (2E,3Z)-2,3-di(ethylidene)quinolin-4-amine;ethane |
| PubChem CID | 143448246 |
| Molecular Formula | C17H26N2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.21 |
| IUPAC Name | (2E,3Z)-2,3-di(ethylidene)quinolin-4-amine;ethane |
| SMILES | C/C=c1/c(N)c2ccccc2n/c1=C/C.CC.CC |
| InChI | InChI=1S/C13H14N2.2C2H6/c1-3-9-11(4-2)15-12-8-6-5-7-10(12)13(9)14;2*1-2/h3-8H,14H2,1-2H3;2*1-2H3/b9-3+,11-4+;; |
| InChIKey | FZIOYQWTWQVPOH-ADZUHMSPSA-N |
| XLogP | 3.47 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2E,3Z)-2,3-di(ethylidene)quinolin-4-amine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,3Z)-2,3-di(ethylidene)quinolin-4-amine;ethane?
The IUPAC name of (2E,3Z)-2,3-di(ethylidene)quinolin-4-amine;ethane (CID 143448246) is (2E,3Z)-2,3-di(ethylidene)quinolin-4-amine;ethane.
What is the SMILES notation for (2E,3Z)-2,3-di(ethylidene)quinolin-4-amine;ethane?
The canonical SMILES for (2E,3Z)-2,3-di(ethylidene)quinolin-4-amine;ethane is C/C=c1/c(N)c2ccccc2n/c1=C/C.CC.CC.
What is the InChIKey of (2E,3Z)-2,3-di(ethylidene)quinolin-4-amine;ethane?
The InChIKey is FZIOYQWTWQVPOH-ADZUHMSPSA-N. The full InChI is InChI=1S/C13H14N2.2C2H6/c1-3-9-11(4-2)15-12-8-6-5-7-10(12)13(9)14;2*1-2/h3-8H,14H2,1-2H3;2*1-2H3/b9-3+,11-4+;;.
What are the key properties of (2E,3Z)-2,3-di(ethylidene)quinolin-4-amine;ethane?
(2E,3Z)-2,3-di(ethylidene)quinolin-4-amine;ethane has a molecular weight of 258.41 g/mol, XLogP of 3.47, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,3Z)-2,3-di(ethylidene)quinolin-4-amine;ethane is sourced from PubChem (CID 143448246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).