C23H34O5 — CID 143448373
(2R,4S,6S,7R,10R,13R,16S,18S)-4-ethenyl-7,19,20,20-tetramethyl-3,5,11-trioxapentacyclo[14.3.1.02,6.07,14.010,13]icos-1(19)-ene-16,18-diol (PubChem CID 143448373) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is (2R,4S,6S,7R,10R,13R,16S,18S)-4-ethenyl-7,19,20,20-tetramethyl-3,5,11-trioxapentacyclo[14.3.1.02,6.07,14.010,13]icos-1(19)-ene-16,18-diol.
| Compound Name | (2R,4S,6S,7R,10R,13R,16S,18S)-4-ethenyl-7,19,20,20-tetramethyl-3,5,11-trioxapentacyclo[14.3.1.02,6.07,14.010,13]icos-1(19)-ene-16,18-diol |
|---|---|
| PubChem CID | 143448373 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | (2R,4S,6S,7R,10R,13R,16S,18S)-4-ethenyl-7,19,20,20-tetramethyl-3,5,11-trioxapentacyclo[14.3.1.02,6.07,14.010,13]icos-1(19)-ene-16,18-diol |
| SMILES | C=C[C@@H]1O[C@@H]2C3=C(C)[C@@H](O)C[C@@](O)(CC4[C@@H]5CO[C@@H]5CC[C@@]4(C)[C@@H]2O1)C3(C)C |
| InChI | InChI=1S/C23H34O5/c1-6-17-27-19-18-12(2)15(24)10-23(25,21(18,3)4)9-14-13-11-26-16(13)7-8-22(14,5)20(19)28-17/h6,13-17,19-20,24-25H,1,7-11H2,2-5H3/t13-,14?,15-,16+,17+,19+,20+,22+,23-/m0/s1 |
| InChIKey | YLUIVAFIPGQEMS-XLMAUSBQSA-N |
| XLogP | 2.96 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|