C28H46O6 — CID 143448384
ethanol;(13R,14Z)-4-ethenyl-16-hydroperoxy-7,19,20,20-tetramethyl-3,5,11-trioxapentacyclo[14.3.1.02,6.07,14.010,13]icosa-1(19),14-diene;propane (PubChem CID 143448384) has the molecular formula C28H46O6 and a molecular weight of 478.67 g/mol. Its IUPAC name is ethanol;(13R,14Z)-4-ethenyl-16-hydroperoxy-7,19,20,20-tetramethyl-3,5,11-trioxapentacyclo[14.3.1.02,6.07,14.010,13]icosa-1(19),14-diene;propane.
| Compound Name | ethanol;(13R,14Z)-4-ethenyl-16-hydroperoxy-7,19,20,20-tetramethyl-3,5,11-trioxapentacyclo[14.3.1.02,6.07,14.010,13]icosa-1(19),14-diene;propane |
|---|---|
| PubChem CID | 143448384 |
| Molecular Formula | C28H46O6 |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.33 |
| IUPAC Name | ethanol;(13R,14Z)-4-ethenyl-16-hydroperoxy-7,19,20,20-tetramethyl-3,5,11-trioxapentacyclo[14.3.1.02,6.07,14.010,13]icosa-1(19),14-diene;propane |
| SMILES | C=CC1OC2C3=C(C)CCC(OO)(/C=C4/[C@@H]5COC5CCC4(C)C2O1)C3(C)C.CCC.CCO |
| InChI | InChI=1S/C23H32O5.C3H8.C2H6O/c1-6-17-26-19-18-13(2)7-10-23(28-24,21(18,3)4)11-15-14-12-25-16(14)8-9-22(15,5)20(19)27-17;1-3-2;1-2-3/h6,11,14,16-17,19-20,24H,1,7-10,12H2,2-5H3;3H2,1-2H3;3H,2H2,1H3/b15-11-;;/t14-,16?,17?,19?,20?,22?,23?;;/m0../s1 |
| InChIKey | DXWGRYFCGRQFPN-ZNZFBSQSSA-N |
| XLogP | 5.82 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|