C24H38O3 — CID 143448387
[(2R,4S,6S,7R,11R,14S)-4-ethenyl-7,14,17,18,18-pentamethyl-3,5-dioxatetracyclo[12.3.1.02,6.07,12]octadec-1(17)-en-11-yl]methanol (PubChem CID 143448387) has the molecular formula C24H38O3 and a molecular weight of 374.57 g/mol. Its IUPAC name is [(2R,4S,6S,7R,11R,14S)-4-ethenyl-7,14,17,18,18-pentamethyl-3,5-dioxatetracyclo[12.3.1.02,6.07,12]octadec-1(17)-en-11-yl]methanol.
| Compound Name | [(2R,4S,6S,7R,11R,14S)-4-ethenyl-7,14,17,18,18-pentamethyl-3,5-dioxatetracyclo[12.3.1.02,6.07,12]octadec-1(17)-en-11-yl]methanol |
|---|---|
| PubChem CID | 143448387 |
| Molecular Formula | C24H38O3 |
| Molecular Weight | 374.57 g/mol |
| Exact Mass | 374.28 |
| IUPAC Name | [(2R,4S,6S,7R,11R,14S)-4-ethenyl-7,14,17,18,18-pentamethyl-3,5-dioxatetracyclo[12.3.1.02,6.07,12]octadec-1(17)-en-11-yl]methanol |
| SMILES | C=C[C@@H]1O[C@@H]2C3=C(C)CC[C@@](C)(CC4[C@H](CO)CCC[C@@]4(C)[C@@H]2O1)C3(C)C |
| InChI | InChI=1S/C24H38O3/c1-7-18-26-20-19-15(2)10-12-23(5,22(19,3)4)13-17-16(14-25)9-8-11-24(17,6)21(20)27-18/h7,16-18,20-21,25H,1,8-14H2,2-6H3/t16-,17?,18+,20+,21+,23-,24+/m0/s1 |
| InChIKey | LOFGWTPYNNLWRS-GOSABEJXSA-N |
| XLogP | 5.24 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.57 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|