C30H46O5 — CID 143448437
4-tetracyclo[6.2.1.13,6.02,7]dodecanyl 2-methylprop-2-enoate;1-[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]ethyl acetate (PubChem CID 143448437) has the molecular formula C30H46O5 and a molecular weight of 486.69 g/mol. Its IUPAC name is 4-tetracyclo[6.2.1.13,6.02,7]dodecanyl 2-methylprop-2-enoate;1-[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]ethyl acetate.
| Compound Name | 4-tetracyclo[6.2.1.13,6.02,7]dodecanyl 2-methylprop-2-enoate;1-[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]ethyl acetate |
|---|---|
| PubChem CID | 143448437 |
| Molecular Formula | C30H46O5 |
| Molecular Weight | 486.69 g/mol |
| Exact Mass | 486.33 |
| IUPAC Name | 4-tetracyclo[6.2.1.13,6.02,7]dodecanyl 2-methylprop-2-enoate;1-[(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)oxy]ethyl acetate |
| SMILES | C=C(C)C(=O)OC1CC2CC1C1C3CCC(C3)C21.CC(=O)OC(C)OC1C2(C)CCC(C2)C1(C)C |
| InChI | InChI=1S/C16H22O2.C14H24O3/c1-8(2)16(17)18-13-7-11-6-12(13)15-10-4-3-9(5-10)14(11)15;1-9(15)16-10(2)17-12-13(3,4)11-6-7-14(12,5)8-11/h9-15H,1,3-7H2,2H3;10-12H,6-8H2,1-5H3 |
| InChIKey | QLXJEHBCWZZOPS-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.69 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|