C20H30F2N4O3 — CID 143448590
(2Z)-2-[2-[(E)-3-[(2,4-difluorocyclohexa-2,4-dien-1-yl)methylamino]prop-1-enyl]-4-hydroxy-4,6,7,8-tetrahydro-1H-pyrazolo[1,2-a][1,2,4]triazin-3-ylidene]propanal;methanol (PubChem CID 143448590) has the molecular formula C20H30F2N4O3 and a molecular weight of 412.48 g/mol. Its IUPAC name is (2Z)-2-[2-[(E)-3-[(2,4-difluorocyclohexa-2,4-dien-1-yl)methylamino]prop-1-enyl]-4-hydroxy-4,6,7,8-tetrahydro-1H-pyrazolo[1,2-a][1,2,4]triazin-3-ylidene]propanal;methanol.
| Compound Name | (2Z)-2-[2-[(E)-3-[(2,4-difluorocyclohexa-2,4-dien-1-yl)methylamino]prop-1-enyl]-4-hydroxy-4,6,7,8-tetrahydro-1H-pyrazolo[1,2-a][1,2,4]triazin-3-ylidene]propanal;methanol |
|---|---|
| PubChem CID | 143448590 |
| Molecular Formula | C20H30F2N4O3 |
| Molecular Weight | 412.48 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | (2Z)-2-[2-[(E)-3-[(2,4-difluorocyclohexa-2,4-dien-1-yl)methylamino]prop-1-enyl]-4-hydroxy-4,6,7,8-tetrahydro-1H-pyrazolo[1,2-a][1,2,4]triazin-3-ylidene]propanal;methanol |
| SMILES | C/C(C=O)=C1\C(O)N2CCCN2CN1/C=C/CNCC1CC=C(F)C=C1F.CO |
| InChI | InChI=1S/C19H26F2N4O2.CH4O/c1-14(12-26)18-19(27)25-9-3-8-24(25)13-23(18)7-2-6-22-11-15-4-5-16(20)10-17(15)21;1-2/h2,5,7,10,12,15,19,22,27H,3-4,6,8-9,11,13H2,1H3;2H,1H3/b7-2+,18-14-; |
| InChIKey | KZFRVWRGTAVPJP-NACXMATBSA-N |
| XLogP | 1.41 |
| TPSA | 79.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.48 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|