C13H21F2N3 — CID 143448670
(E)-N-[(2,4-difluorocyclohexa-2,4-dien-1-yl)methyl]-4-(2,2-dimethylhydrazinyl)but-3-en-2-amine (PubChem CID 143448670) has the molecular formula C13H21F2N3 and a molecular weight of 257.33 g/mol. Its IUPAC name is (E)-N-[(2,4-difluorocyclohexa-2,4-dien-1-yl)methyl]-4-(2,2-dimethylhydrazinyl)but-3-en-2-amine.
| Compound Name | (E)-N-[(2,4-difluorocyclohexa-2,4-dien-1-yl)methyl]-4-(2,2-dimethylhydrazinyl)but-3-en-2-amine |
|---|---|
| PubChem CID | 143448670 |
| Molecular Formula | C13H21F2N3 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.17 |
| IUPAC Name | (E)-N-[(2,4-difluorocyclohexa-2,4-dien-1-yl)methyl]-4-(2,2-dimethylhydrazinyl)but-3-en-2-amine |
| SMILES | CC(/C=C/NN(C)C)NCC1CC=C(F)C=C1F |
| InChI | InChI=1S/C13H21F2N3/c1-10(6-7-17-18(2)3)16-9-11-4-5-12(14)8-13(11)15/h5-8,10-11,16-17H,4,9H2,1-3H3/b7-6+ |
| InChIKey | ZAERMWHNJSEFHF-VOTSOKGWSA-N |
| XLogP | 2.27 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|