About N-[(Z)-4-[6-(2,6-dimethylphenyl)-3-pyridinyl]-1-ethylsulfanylbut-1-en-3-yn-2-yl]methanimine
N-[(Z)-4-[6-(2,6-dimethylphenyl)-3-pyridinyl]-1-ethylsulfanylbut-1-en-3-yn-2-yl]methanimine (PubChem CID 143449012) has the molecular formula C20H20N2S
and a molecular weight of 320.46 g/mol. Its IUPAC name is N-[(Z)-4-[6-(2,6-dimethylphenyl)-3-pyridinyl]-1-ethylsulfanylbut-1-en-3-yn-2-yl]methanimine.
Molecular Properties
| Compound Name | N-[(Z)-4-[6-(2,6-dimethylphenyl)-3-pyridinyl]-1-ethylsulfanylbut-1-en-3-yn-2-yl]methanimine |
| PubChem CID | 143449012 |
| Molecular Formula | C20H20N2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | N-[(Z)-4-[6-(2,6-dimethylphenyl)-3-pyridinyl]-1-ethylsulfanylbut-1-en-3-yn-2-yl]methanimine |
| SMILES | C=N/C(C#Cc1ccc(-c2c(C)cccc2C)nc1)=C\SCC |
| InChI | InChI=1S/C20H20N2S/c1-5-23-14-18(21-4)11-9-17-10-12-19(22-13-17)20-15(2)7-6-8-16(20)3/h6-8,10,12-14H,4-5H2,1-3H3/b18-14- |
| InChIKey | CVUKQMULLQMODV-JXAWBTAJSA-N |
| XLogP | 5.01 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[(Z)-4-[6-(2,6-dimethylphenyl)-3-pyridinyl]-1-ethylsulfanylbut-1-en-3-yn-2-yl]methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(Z)-4-[6-(2,6-dimethylphenyl)-3-pyridinyl]-1-ethylsulfanylbut-1-en-3-yn-2-yl]methanimine?
The IUPAC name of N-[(Z)-4-[6-(2,6-dimethylphenyl)-3-pyridinyl]-1-ethylsulfanylbut-1-en-3-yn-2-yl]methanimine (CID 143449012) is N-[(Z)-4-[6-(2,6-dimethylphenyl)-3-pyridinyl]-1-ethylsulfanylbut-1-en-3-yn-2-yl]methanimine.
What is the SMILES notation for N-[(Z)-4-[6-(2,6-dimethylphenyl)-3-pyridinyl]-1-ethylsulfanylbut-1-en-3-yn-2-yl]methanimine?
The canonical SMILES for N-[(Z)-4-[6-(2,6-dimethylphenyl)-3-pyridinyl]-1-ethylsulfanylbut-1-en-3-yn-2-yl]methanimine is C=N/C(C#Cc1ccc(-c2c(C)cccc2C)nc1)=C\SCC.
What is the InChIKey of N-[(Z)-4-[6-(2,6-dimethylphenyl)-3-pyridinyl]-1-ethylsulfanylbut-1-en-3-yn-2-yl]methanimine?
The InChIKey is CVUKQMULLQMODV-JXAWBTAJSA-N. The full InChI is InChI=1S/C20H20N2S/c1-5-23-14-18(21-4)11-9-17-10-12-19(22-13-17)20-15(2)7-6-8-16(20)3/h6-8,10,12-14H,4-5H2,1-3H3/b18-14-.
What are the key properties of N-[(Z)-4-[6-(2,6-dimethylphenyl)-3-pyridinyl]-1-ethylsulfanylbut-1-en-3-yn-2-yl]methanimine?
N-[(Z)-4-[6-(2,6-dimethylphenyl)-3-pyridinyl]-1-ethylsulfanylbut-1-en-3-yn-2-yl]methanimine has a molecular weight of 320.46 g/mol, XLogP of 5.01, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(Z)-4-[6-(2,6-dimethylphenyl)-3-pyridinyl]-1-ethylsulfanylbut-1-en-3-yn-2-yl]methanimine is sourced from PubChem (CID 143449012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).