About ethane;(1Z)-1-[(Z)-ethylideneamino]-2-methyl-N,N-dipropylbuta-1,3-dien-1-amine
ethane;(1Z)-1-[(Z)-ethylideneamino]-2-methyl-N,N-dipropylbuta-1,3-dien-1-amine (PubChem CID 143449322) has the molecular formula C15H30N2
and a molecular weight of 238.42 g/mol. Its IUPAC name is ethane;(1Z)-1-[(Z)-ethylideneamino]-2-methyl-N,N-dipropylbuta-1,3-dien-1-amine.
Molecular Properties
| Compound Name | ethane;(1Z)-1-[(Z)-ethylideneamino]-2-methyl-N,N-dipropylbuta-1,3-dien-1-amine |
| PubChem CID | 143449322 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | ethane;(1Z)-1-[(Z)-ethylideneamino]-2-methyl-N,N-dipropylbuta-1,3-dien-1-amine |
| SMILES | C=C/C(C)=C(\N=C/C)N(CCC)CCC.CC |
| InChI | InChI=1S/C13H24N2.C2H6/c1-6-10-15(11-7-2)13(14-9-4)12(5)8-3;1-2/h8-9H,3,6-7,10-11H2,1-2,4-5H3;1-2H3/b13-12+,14-9-; |
| InChIKey | QBEINLBKIDJGKD-MTDYQGICSA-N |
| XLogP | 4.64 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(1Z)-1-[(Z)-ethylideneamino]-2-methyl-N,N-dipropylbuta-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(1Z)-1-[(Z)-ethylideneamino]-2-methyl-N,N-dipropylbuta-1,3-dien-1-amine?
The IUPAC name of ethane;(1Z)-1-[(Z)-ethylideneamino]-2-methyl-N,N-dipropylbuta-1,3-dien-1-amine (CID 143449322) is ethane;(1Z)-1-[(Z)-ethylideneamino]-2-methyl-N,N-dipropylbuta-1,3-dien-1-amine.
What is the SMILES notation for ethane;(1Z)-1-[(Z)-ethylideneamino]-2-methyl-N,N-dipropylbuta-1,3-dien-1-amine?
The canonical SMILES for ethane;(1Z)-1-[(Z)-ethylideneamino]-2-methyl-N,N-dipropylbuta-1,3-dien-1-amine is C=C/C(C)=C(\N=C/C)N(CCC)CCC.CC.
What is the InChIKey of ethane;(1Z)-1-[(Z)-ethylideneamino]-2-methyl-N,N-dipropylbuta-1,3-dien-1-amine?
The InChIKey is QBEINLBKIDJGKD-MTDYQGICSA-N. The full InChI is InChI=1S/C13H24N2.C2H6/c1-6-10-15(11-7-2)13(14-9-4)12(5)8-3;1-2/h8-9H,3,6-7,10-11H2,1-2,4-5H3;1-2H3/b13-12+,14-9-;.
What are the key properties of ethane;(1Z)-1-[(Z)-ethylideneamino]-2-methyl-N,N-dipropylbuta-1,3-dien-1-amine?
ethane;(1Z)-1-[(Z)-ethylideneamino]-2-methyl-N,N-dipropylbuta-1,3-dien-1-amine has a molecular weight of 238.42 g/mol, XLogP of 4.64, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(1Z)-1-[(Z)-ethylideneamino]-2-methyl-N,N-dipropylbuta-1,3-dien-1-amine is sourced from PubChem (CID 143449322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).