About ethane;6-methyl-7-piperidin-1-yl-4,5-dihydro-3H-azepine
ethane;6-methyl-7-piperidin-1-yl-4,5-dihydro-3H-azepine (PubChem CID 143449329) has the molecular formula C14H26N2
and a molecular weight of 222.38 g/mol. Its IUPAC name is ethane;6-methyl-7-piperidin-1-yl-4,5-dihydro-3H-azepine.
Molecular Properties
| Compound Name | ethane;6-methyl-7-piperidin-1-yl-4,5-dihydro-3H-azepine |
| PubChem CID | 143449329 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | ethane;6-methyl-7-piperidin-1-yl-4,5-dihydro-3H-azepine |
| SMILES | CC.CC1=C(N2CCCCC2)N=CCCC1 |
| InChI | InChI=1S/C12H20N2.C2H6/c1-11-7-3-4-8-13-12(11)14-9-5-2-6-10-14;1-2/h8H,2-7,9-10H2,1H3;1-2H3 |
| InChIKey | LLZOPJWZLBWXEN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;6-methyl-7-piperidin-1-yl-4,5-dihydro-3H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-methyl-7-piperidin-1-yl-4,5-dihydro-3H-azepine?
The IUPAC name of ethane;6-methyl-7-piperidin-1-yl-4,5-dihydro-3H-azepine (CID 143449329) is ethane;6-methyl-7-piperidin-1-yl-4,5-dihydro-3H-azepine.
What is the SMILES notation for ethane;6-methyl-7-piperidin-1-yl-4,5-dihydro-3H-azepine?
The canonical SMILES for ethane;6-methyl-7-piperidin-1-yl-4,5-dihydro-3H-azepine is CC.CC1=C(N2CCCCC2)N=CCCC1.
What is the InChIKey of ethane;6-methyl-7-piperidin-1-yl-4,5-dihydro-3H-azepine?
The InChIKey is LLZOPJWZLBWXEN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2.C2H6/c1-11-7-3-4-8-13-12(11)14-9-5-2-6-10-14;1-2/h8H,2-7,9-10H2,1H3;1-2H3.
What are the key properties of ethane;6-methyl-7-piperidin-1-yl-4,5-dihydro-3H-azepine?
ethane;6-methyl-7-piperidin-1-yl-4,5-dihydro-3H-azepine has a molecular weight of 222.38 g/mol, XLogP of 3.98, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-methyl-7-piperidin-1-yl-4,5-dihydro-3H-azepine is sourced from PubChem (CID 143449329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).