About 5-methyl-4-piperidin-1-yl-3-azabicyclo[4.1.0]hepta-2,4-diene
5-methyl-4-piperidin-1-yl-3-azabicyclo[4.1.0]hepta-2,4-diene (PubChem CID 143449343) has the molecular formula C12H18N2
and a molecular weight of 190.29 g/mol. Its IUPAC name is 5-methyl-4-piperidin-1-yl-3-azabicyclo[4.1.0]hepta-2,4-diene.
Molecular Properties
| Compound Name | 5-methyl-4-piperidin-1-yl-3-azabicyclo[4.1.0]hepta-2,4-diene |
| PubChem CID | 143449343 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 5-methyl-4-piperidin-1-yl-3-azabicyclo[4.1.0]hepta-2,4-diene |
| SMILES | CC1=C(N2CCCCC2)N=CC2CC12 |
| InChI | InChI=1S/C12H18N2/c1-9-11-7-10(11)8-13-12(9)14-5-3-2-4-6-14/h8,10-11H,2-7H2,1H3 |
| InChIKey | JXYJGDQVACLODU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-4-piperidin-1-yl-3-azabicyclo[4.1.0]hepta-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-4-piperidin-1-yl-3-azabicyclo[4.1.0]hepta-2,4-diene?
The IUPAC name of 5-methyl-4-piperidin-1-yl-3-azabicyclo[4.1.0]hepta-2,4-diene (CID 143449343) is 5-methyl-4-piperidin-1-yl-3-azabicyclo[4.1.0]hepta-2,4-diene.
What is the SMILES notation for 5-methyl-4-piperidin-1-yl-3-azabicyclo[4.1.0]hepta-2,4-diene?
The canonical SMILES for 5-methyl-4-piperidin-1-yl-3-azabicyclo[4.1.0]hepta-2,4-diene is CC1=C(N2CCCCC2)N=CC2CC12.
What is the InChIKey of 5-methyl-4-piperidin-1-yl-3-azabicyclo[4.1.0]hepta-2,4-diene?
The InChIKey is JXYJGDQVACLODU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2/c1-9-11-7-10(11)8-13-12(9)14-5-3-2-4-6-14/h8,10-11H,2-7H2,1H3.
What are the key properties of 5-methyl-4-piperidin-1-yl-3-azabicyclo[4.1.0]hepta-2,4-diene?
5-methyl-4-piperidin-1-yl-3-azabicyclo[4.1.0]hepta-2,4-diene has a molecular weight of 190.29 g/mol, XLogP of 2.42, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-4-piperidin-1-yl-3-azabicyclo[4.1.0]hepta-2,4-diene is sourced from PubChem (CID 143449343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).