About 7-[(1Z)-buta-1,3-dienyl]-3-chloro-6-ethylpyrido[2,3-b]azepin-5-one
7-[(1Z)-buta-1,3-dienyl]-3-chloro-6-ethylpyrido[2,3-b]azepin-5-one (PubChem CID 143449624) has the molecular formula C15H13ClN2O
and a molecular weight of 272.74 g/mol. Its IUPAC name is 7-[(1Z)-buta-1,3-dienyl]-3-chloro-6-ethylpyrido[2,3-b]azepin-5-one.
Molecular Properties
| Compound Name | 7-[(1Z)-buta-1,3-dienyl]-3-chloro-6-ethylpyrido[2,3-b]azepin-5-one |
| PubChem CID | 143449624 |
| Molecular Formula | C15H13ClN2O |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 7-[(1Z)-buta-1,3-dienyl]-3-chloro-6-ethylpyrido[2,3-b]azepin-5-one |
| SMILES | C=C/C=C\c1cnc2ncc(Cl)cc2c(=O)c1CC |
| InChI | InChI=1S/C15H13ClN2O/c1-3-5-6-10-8-17-15-13(7-11(16)9-18-15)14(19)12(10)4-2/h3,5-9H,1,4H2,2H3/b6-5- |
| InChIKey | DXOLLOUHVNMXTR-WAYWQWQTSA-N |
| XLogP | 3.40 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 7-[(1Z)-buta-1,3-dienyl]-3-chloro-6-ethylpyrido[2,3-b]azepin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(1Z)-buta-1,3-dienyl]-3-chloro-6-ethylpyrido[2,3-b]azepin-5-one?
The IUPAC name of 7-[(1Z)-buta-1,3-dienyl]-3-chloro-6-ethylpyrido[2,3-b]azepin-5-one (CID 143449624) is 7-[(1Z)-buta-1,3-dienyl]-3-chloro-6-ethylpyrido[2,3-b]azepin-5-one.
What is the SMILES notation for 7-[(1Z)-buta-1,3-dienyl]-3-chloro-6-ethylpyrido[2,3-b]azepin-5-one?
The canonical SMILES for 7-[(1Z)-buta-1,3-dienyl]-3-chloro-6-ethylpyrido[2,3-b]azepin-5-one is C=C/C=C\c1cnc2ncc(Cl)cc2c(=O)c1CC.
What is the InChIKey of 7-[(1Z)-buta-1,3-dienyl]-3-chloro-6-ethylpyrido[2,3-b]azepin-5-one?
The InChIKey is DXOLLOUHVNMXTR-WAYWQWQTSA-N. The full InChI is InChI=1S/C15H13ClN2O/c1-3-5-6-10-8-17-15-13(7-11(16)9-18-15)14(19)12(10)4-2/h3,5-9H,1,4H2,2H3/b6-5-.
What are the key properties of 7-[(1Z)-buta-1,3-dienyl]-3-chloro-6-ethylpyrido[2,3-b]azepin-5-one?
7-[(1Z)-buta-1,3-dienyl]-3-chloro-6-ethylpyrido[2,3-b]azepin-5-one has a molecular weight of 272.74 g/mol, XLogP of 3.40, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(1Z)-buta-1,3-dienyl]-3-chloro-6-ethylpyrido[2,3-b]azepin-5-one is sourced from PubChem (CID 143449624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).