C16H15F6NO4S — CID 143449650
methyl 4-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-4-oxobutanoate (PubChem CID 143449650) has the molecular formula C16H15F6NO4S and a molecular weight of 431.35 g/mol. Its IUPAC name is methyl 4-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-4-oxobutanoate.
| Compound Name | methyl 4-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-4-oxobutanoate |
|---|---|
| PubChem CID | 143449650 |
| Molecular Formula | C16H15F6NO4S |
| Molecular Weight | 431.35 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | methyl 4-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)N1CCSc2cc(C(O)(C(F)(F)F)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C16H15F6NO4S/c1-27-13(25)5-4-12(24)23-6-7-28-11-8-9(2-3-10(11)23)14(26,15(17,18)19)16(20,21)22/h2-3,8,26H,4-7H2,1H3 |
| InChIKey | CGYBZVRFWWIHRI-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.35 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |