C18H17F6NO4S — CID 143449657
[2-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-[(E)-prop-1-enyl]-2,3-dihydro-1,4-benzothiazin-4-yl]-2-oxoethyl] acetate (PubChem CID 143449657) has the molecular formula C18H17F6NO4S and a molecular weight of 457.39 g/mol. Its IUPAC name is [2-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-[(E)-prop-1-enyl]-2,3-dihydro-1,4-benzothiazin-4-yl]-2-oxoethyl] acetate.
| Compound Name | [2-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-[(E)-prop-1-enyl]-2,3-dihydro-1,4-benzothiazin-4-yl]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 143449657 |
| Molecular Formula | C18H17F6NO4S |
| Molecular Weight | 457.39 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | [2-[7-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-2-[(E)-prop-1-enyl]-2,3-dihydro-1,4-benzothiazin-4-yl]-2-oxoethyl] acetate |
| SMILES | C/C=C/C1CN(C(=O)COC(C)=O)c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2S1 |
| InChI | InChI=1S/C18H17F6NO4S/c1-3-4-12-8-25(15(27)9-29-10(2)26)13-6-5-11(7-14(13)30-12)16(28,17(19,20)21)18(22,23)24/h3-7,12,28H,8-9H2,1-2H3/b4-3+ |
| InChIKey | YPXOGTWMZRQRQW-ONEGZZNKSA-N |
| XLogP | 3.95 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.39 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|