C20H16F6N2O3S — CID 143449704
1-[7-(1,1,1,3,3,3-hexafluoro-2-nitrosopropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-2-phenylmethoxyethanone (PubChem CID 143449704) has the molecular formula C20H16F6N2O3S and a molecular weight of 478.41 g/mol. Its IUPAC name is 1-[7-(1,1,1,3,3,3-hexafluoro-2-nitrosopropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-2-phenylmethoxyethanone.
| Compound Name | 1-[7-(1,1,1,3,3,3-hexafluoro-2-nitrosopropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-2-phenylmethoxyethanone |
|---|---|
| PubChem CID | 143449704 |
| Molecular Formula | C20H16F6N2O3S |
| Molecular Weight | 478.41 g/mol |
| Exact Mass | 478.08 |
| IUPAC Name | 1-[7-(1,1,1,3,3,3-hexafluoro-2-nitrosopropan-2-yl)-2,3-dihydro-1,4-benzothiazin-4-yl]-2-phenylmethoxyethanone |
| SMILES | O=NC(c1ccc2c(c1)SCCN2C(=O)COCc1ccccc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C20H16F6N2O3S/c21-19(22,23)18(27-30,20(24,25)26)14-6-7-15-16(10-14)32-9-8-28(15)17(29)12-31-11-13-4-2-1-3-5-13/h1-7,10H,8-9,11-12H2 |
| InChIKey | FGGLANZCONVZNN-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.41 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |