About [3-fluoro-2-methyl-6-(methylamino)phenyl] formate;propane
[3-fluoro-2-methyl-6-(methylamino)phenyl] formate;propane (PubChem CID 143450651) has the molecular formula C12H18FNO2
and a molecular weight of 227.28 g/mol. Its IUPAC name is [3-fluoro-2-methyl-6-(methylamino)phenyl] formate;propane.
Molecular Properties
| Compound Name | [3-fluoro-2-methyl-6-(methylamino)phenyl] formate;propane |
| PubChem CID | 143450651 |
| Molecular Formula | C12H18FNO2 |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | [3-fluoro-2-methyl-6-(methylamino)phenyl] formate;propane |
| SMILES | CCC.CNc1ccc(F)c(C)c1OC=O |
| InChI | InChI=1S/C9H10FNO2.C3H8/c1-6-7(10)3-4-8(11-2)9(6)13-5-12;1-3-2/h3-5,11H,1-2H3;3H2,1-2H3 |
| InChIKey | OQPOTHVZFVJSHK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze [3-fluoro-2-methyl-6-(methylamino)phenyl] formate;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-fluoro-2-methyl-6-(methylamino)phenyl] formate;propane?
The IUPAC name of [3-fluoro-2-methyl-6-(methylamino)phenyl] formate;propane (CID 143450651) is [3-fluoro-2-methyl-6-(methylamino)phenyl] formate;propane.
What is the SMILES notation for [3-fluoro-2-methyl-6-(methylamino)phenyl] formate;propane?
The canonical SMILES for [3-fluoro-2-methyl-6-(methylamino)phenyl] formate;propane is CCC.CNc1ccc(F)c(C)c1OC=O.
What is the InChIKey of [3-fluoro-2-methyl-6-(methylamino)phenyl] formate;propane?
The InChIKey is OQPOTHVZFVJSHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10FNO2.C3H8/c1-6-7(10)3-4-8(11-2)9(6)13-5-12;1-3-2/h3-5,11H,1-2H3;3H2,1-2H3.
What are the key properties of [3-fluoro-2-methyl-6-(methylamino)phenyl] formate;propane?
[3-fluoro-2-methyl-6-(methylamino)phenyl] formate;propane has a molecular weight of 227.28 g/mol, XLogP of 3.13, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-fluoro-2-methyl-6-(methylamino)phenyl] formate;propane is sourced from PubChem (CID 143450651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).