About N-[(1E)-1-(disulfanyl)buta-1,3-dienyl]methanimine;ethane
N-[(1E)-1-(disulfanyl)buta-1,3-dienyl]methanimine;ethane (PubChem CID 143450889) has the molecular formula C9H19NS2
and a molecular weight of 205.39 g/mol. Its IUPAC name is N-[(1E)-1-(disulfanyl)buta-1,3-dienyl]methanimine;ethane.
Molecular Properties
| Compound Name | N-[(1E)-1-(disulfanyl)buta-1,3-dienyl]methanimine;ethane |
| PubChem CID | 143450889 |
| Molecular Formula | C9H19NS2 |
| Molecular Weight | 205.39 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | N-[(1E)-1-(disulfanyl)buta-1,3-dienyl]methanimine;ethane |
| SMILES | C=C/C=C(\N=C)SS.CC.CC |
| InChI | InChI=1S/C5H7NS2.2C2H6/c1-3-4-5(6-2)8-7;2*1-2/h3-4,7H,1-2H2;2*1-2H3/b5-4+;; |
| InChIKey | LJYRFXFZKOFVCC-SFKRKKMESA-N |
| XLogP | 4.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.39 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-[(1E)-1-(disulfanyl)buta-1,3-dienyl]methanimine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1E)-1-(disulfanyl)buta-1,3-dienyl]methanimine;ethane?
The IUPAC name of N-[(1E)-1-(disulfanyl)buta-1,3-dienyl]methanimine;ethane (CID 143450889) is N-[(1E)-1-(disulfanyl)buta-1,3-dienyl]methanimine;ethane.
What is the SMILES notation for N-[(1E)-1-(disulfanyl)buta-1,3-dienyl]methanimine;ethane?
The canonical SMILES for N-[(1E)-1-(disulfanyl)buta-1,3-dienyl]methanimine;ethane is C=C/C=C(\N=C)SS.CC.CC.
What is the InChIKey of N-[(1E)-1-(disulfanyl)buta-1,3-dienyl]methanimine;ethane?
The InChIKey is LJYRFXFZKOFVCC-SFKRKKMESA-N. The full InChI is InChI=1S/C5H7NS2.2C2H6/c1-3-4-5(6-2)8-7;2*1-2/h3-4,7H,1-2H2;2*1-2H3/b5-4+;;.
What are the key properties of N-[(1E)-1-(disulfanyl)buta-1,3-dienyl]methanimine;ethane?
N-[(1E)-1-(disulfanyl)buta-1,3-dienyl]methanimine;ethane has a molecular weight of 205.39 g/mol, XLogP of 4.34, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1E)-1-(disulfanyl)buta-1,3-dienyl]methanimine;ethane is sourced from PubChem (CID 143450889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).