C25H31NO2S — CID 143450944
(Z,3E)-N-[[(2R)-7-(benzenesulfinyl)-3,4-dihydro-2H-chromen-2-yl]methyl]-3-ethylidenehept-4-en-2-amine (PubChem CID 143450944) has the molecular formula C25H31NO2S and a molecular weight of 409.60 g/mol. Its IUPAC name is (Z,3E)-N-[[(2R)-7-(benzenesulfinyl)-3,4-dihydro-2H-chromen-2-yl]methyl]-3-ethylidenehept-4-en-2-amine.
| Compound Name | (Z,3E)-N-[[(2R)-7-(benzenesulfinyl)-3,4-dihydro-2H-chromen-2-yl]methyl]-3-ethylidenehept-4-en-2-amine |
|---|---|
| PubChem CID | 143450944 |
| Molecular Formula | C25H31NO2S |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.21 |
| IUPAC Name | (Z,3E)-N-[[(2R)-7-(benzenesulfinyl)-3,4-dihydro-2H-chromen-2-yl]methyl]-3-ethylidenehept-4-en-2-amine |
| SMILES | C/C=C(\C=C/CC)C(C)NC[C@H]1CCc2ccc(S(=O)c3ccccc3)cc2O1 |
| InChI | InChI=1S/C25H31NO2S/c1-4-6-10-20(5-2)19(3)26-18-22-15-13-21-14-16-24(17-25(21)28-22)29(27)23-11-8-7-9-12-23/h5-12,14,16-17,19,22,26H,4,13,15,18H2,1-3H3/b10-6-,20-5+/t19?,22-,29?/m1/s1 |
| InChIKey | AFQWCSPVEUBQOY-RDJCMCSWSA-N |
| XLogP | 5.44 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|