C10H13IN4O5S — CID 143451090
5-amino-3-[(2R,4R,5S)-5-hydroxy-4-(hydroxymethyl)-1-methyl-1λ3,3-iodoxolan-2-yl]-6H-[1,3]thiazolo[4,5-d]pyrimidine-2,7-dione (PubChem CID 143451090) has the molecular formula C10H13IN4O5S and a molecular weight of 428.21 g/mol. Its IUPAC name is 5-amino-3-[(2R,4R,5S)-5-hydroxy-4-(hydroxymethyl)-1-methyl-1λ3,3-iodoxolan-2-yl]-6H-[1,3]thiazolo[4,5-d]pyrimidine-2,7-dione.
| Compound Name | 5-amino-3-[(2R,4R,5S)-5-hydroxy-4-(hydroxymethyl)-1-methyl-1λ3,3-iodoxolan-2-yl]-6H-[1,3]thiazolo[4,5-d]pyrimidine-2,7-dione |
|---|---|
| PubChem CID | 143451090 |
| Molecular Formula | C10H13IN4O5S |
| Molecular Weight | 428.21 g/mol |
| Exact Mass | 427.97 |
| IUPAC Name | 5-amino-3-[(2R,4R,5S)-5-hydroxy-4-(hydroxymethyl)-1-methyl-1λ3,3-iodoxolan-2-yl]-6H-[1,3]thiazolo[4,5-d]pyrimidine-2,7-dione |
| SMILES | CI1[C@H](O)[C@@H](CO)O[C@H]1n1c(=O)sc2c(=O)[nH]c(N)nc21 |
| InChI | InChI=1S/C10H13IN4O5S/c1-11-5(17)3(2-16)20-8(11)15-6-4(21-10(15)19)7(18)14-9(12)13-6/h3,5,8,16-17H,2H2,1H3,(H3,12,13,14,18)/t3-,5-,8-/m1/s1 |
| InChIKey | NFRSXCYTNVYGTM-TWOGKDBTSA-N |
| XLogP | -0.97 |
| TPSA | 143.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.21 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|