C27H21Cl2NO — CID 143451226
(2Z,3E,5E)-1-(4-carbazol-9-ylphenyl)-3,6-dichloro-2-ethylidenehepta-3,5-dien-1-one (PubChem CID 143451226) has the molecular formula C27H21Cl2NO and a molecular weight of 446.38 g/mol. Its IUPAC name is (2Z,3E,5E)-1-(4-carbazol-9-ylphenyl)-3,6-dichloro-2-ethylidenehepta-3,5-dien-1-one.
| Compound Name | (2Z,3E,5E)-1-(4-carbazol-9-ylphenyl)-3,6-dichloro-2-ethylidenehepta-3,5-dien-1-one |
|---|---|
| PubChem CID | 143451226 |
| Molecular Formula | C27H21Cl2NO |
| Molecular Weight | 446.38 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | (2Z,3E,5E)-1-(4-carbazol-9-ylphenyl)-3,6-dichloro-2-ethylidenehepta-3,5-dien-1-one |
| SMILES | C/C=C(C(=O)c1ccc(-n2c3ccccc3c3ccccc32)cc1)\C(Cl)=C/C=C(\C)Cl |
| InChI | InChI=1S/C27H21Cl2NO/c1-3-21(24(29)17-12-18(2)28)27(31)19-13-15-20(16-14-19)30-25-10-6-4-8-22(25)23-9-5-7-11-26(23)30/h3-17H,1-2H3/b18-12+,21-3+,24-17+ |
| InChIKey | ASKFUVGLHWKDFQ-FUCRUADPSA-N |
| XLogP | 8.18 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.38 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|