C30H35BN2O2 — CID 143451322
ethane;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritylpyrazole (PubChem CID 143451322) has the molecular formula C30H35BN2O2 and a molecular weight of 466.43 g/mol. Its IUPAC name is ethane;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritylpyrazole.
| Compound Name | ethane;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritylpyrazole |
|---|---|
| PubChem CID | 143451322 |
| Molecular Formula | C30H35BN2O2 |
| Molecular Weight | 466.43 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | ethane;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1-tritylpyrazole |
| SMILES | CC.CC1(C)OB(c2cnn(C(c3ccccc3)(c3ccccc3)c3ccccc3)c2)OC1(C)C |
| InChI | InChI=1S/C28H29BN2O2.C2H6/c1-26(2)27(3,4)33-29(32-26)25-20-30-31(21-25)28(22-14-8-5-9-15-22,23-16-10-6-11-17-23)24-18-12-7-13-19-24;1-2/h5-21H,1-4H3;1-2H3 |
| InChIKey | HMOYBUIGVVLETJ-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.43 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|