About (2-propan-2-ylphenyl) 2,2,2-trifluoroacetate
(2-propan-2-ylphenyl) 2,2,2-trifluoroacetate (PubChem CID 14345166) has the molecular formula C11H11F3O2
and a molecular weight of 232.20 g/mol. Its IUPAC name is (2-propan-2-ylphenyl) 2,2,2-trifluoroacetate.
Molecular Properties
| Compound Name | (2-propan-2-ylphenyl) 2,2,2-trifluoroacetate |
| PubChem CID | 14345166 |
| Molecular Formula | C11H11F3O2 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | (2-propan-2-ylphenyl) 2,2,2-trifluoroacetate |
| SMILES | CC(C)c1ccccc1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C11H11F3O2/c1-7(2)8-5-3-4-6-9(8)16-10(15)11(12,13)14/h3-7H,1-2H3 |
| InChIKey | RGCIVKVZQHAKHH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-propan-2-ylphenyl) 2,2,2-trifluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-propan-2-ylphenyl) 2,2,2-trifluoroacetate?
The IUPAC name of (2-propan-2-ylphenyl) 2,2,2-trifluoroacetate (CID 14345166) is (2-propan-2-ylphenyl) 2,2,2-trifluoroacetate.
What is the SMILES notation for (2-propan-2-ylphenyl) 2,2,2-trifluoroacetate?
The canonical SMILES for (2-propan-2-ylphenyl) 2,2,2-trifluoroacetate is CC(C)c1ccccc1OC(=O)C(F)(F)F.
What is the InChIKey of (2-propan-2-ylphenyl) 2,2,2-trifluoroacetate?
The InChIKey is RGCIVKVZQHAKHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11F3O2/c1-7(2)8-5-3-4-6-9(8)16-10(15)11(12,13)14/h3-7H,1-2H3.
What are the key properties of (2-propan-2-ylphenyl) 2,2,2-trifluoroacetate?
(2-propan-2-ylphenyl) 2,2,2-trifluoroacetate has a molecular weight of 232.20 g/mol, XLogP of 3.28, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-propan-2-ylphenyl) 2,2,2-trifluoroacetate is sourced from PubChem (CID 14345166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).