C36H37FN2O2 — CID 143452089
(3,4-dimethylphenyl)-phenylmethanone;(4E)-4-[ethynyl(phenyl)hydrazinylidene]-4-(4-fluorophenyl)butan-2-one;propane (PubChem CID 143452089) has the molecular formula C36H37FN2O2 and a molecular weight of 548.70 g/mol. Its IUPAC name is (3,4-dimethylphenyl)-phenylmethanone;(4E)-4-[ethynyl(phenyl)hydrazinylidene]-4-(4-fluorophenyl)butan-2-one;propane.
| Compound Name | (3,4-dimethylphenyl)-phenylmethanone;(4E)-4-[ethynyl(phenyl)hydrazinylidene]-4-(4-fluorophenyl)butan-2-one;propane |
|---|---|
| PubChem CID | 143452089 |
| Molecular Formula | C36H37FN2O2 |
| Molecular Weight | 548.70 g/mol |
| Exact Mass | 548.28 |
| IUPAC Name | (3,4-dimethylphenyl)-phenylmethanone;(4E)-4-[ethynyl(phenyl)hydrazinylidene]-4-(4-fluorophenyl)butan-2-one;propane |
| SMILES | C#CN(/N=C(\CC(C)=O)c1ccc(F)cc1)c1ccccc1.CCC.Cc1ccc(C(=O)c2ccccc2)cc1C |
| InChI | InChI=1S/C18H15FN2O.C15H14O.C3H8/c1-3-21(17-7-5-4-6-8-17)20-18(13-14(2)22)15-9-11-16(19)12-10-15;1-11-8-9-14(10-12(11)2)15(16)13-6-4-3-5-7-13;1-3-2/h1,4-12H,13H2,2H3;3-10H,1-2H3;3H2,1-2H3/b20-18+;; |
| InChIKey | UDIKGYBBCSCLJO-VIPPSAFOSA-N |
| XLogP | 8.56 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.70 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|