C15H21N2NaO2OsS — CID 143452875
CID 143452875 (PubChem CID 143452875) has the molecular formula C15H21N2NaO2OsS and a molecular weight of 506.63 g/mol.
| Compound Name | CID 143452875 |
|---|---|
| PubChem CID | 143452875 |
| Molecular Formula | C15H21N2NaO2OsS |
| Molecular Weight | 506.63 g/mol |
| Exact Mass | 508.08 |
| IUPAC Name | — |
| SMILES | CC(C)N1CCN(C(=O)c2ccc(C(O)[S-])cc2)CC1.[Na].[Os+] |
| InChI | InChI=1S/C15H22N2O2S.Na.Os/c1-11(2)16-7-9-17(10-8-16)14(18)12-3-5-13(6-4-12)15(19)20;;/h3-6,11,15,19-20H,7-10H2,1-2H3;;/q;;+1/p-1 |
| InChIKey | RZRIRCQDALZKDX-UHFFFAOYSA-M |
| XLogP | 1.01 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.63 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|