About ethane;(4E,5E)-4-ethylidene-2-methyl-5-propylidene-1H-imidazole
ethane;(4E,5E)-4-ethylidene-2-methyl-5-propylidene-1H-imidazole (PubChem CID 143453484) has the molecular formula C11H20N2
and a molecular weight of 180.29 g/mol. Its IUPAC name is ethane;(4E,5E)-4-ethylidene-2-methyl-5-propylidene-1H-imidazole.
Molecular Properties
| Compound Name | ethane;(4E,5E)-4-ethylidene-2-methyl-5-propylidene-1H-imidazole |
| PubChem CID | 143453484 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | ethane;(4E,5E)-4-ethylidene-2-methyl-5-propylidene-1H-imidazole |
| SMILES | C/C=c1/nc(C)[nH]/c1=C/CC.CC |
| InChI | InChI=1S/C9H14N2.C2H6/c1-4-6-9-8(5-2)10-7(3)11-9;1-2/h5-6H,4H2,1-3H3,(H,10,11);1-2H3/b8-5+,9-6+; |
| InChIKey | KGDKGSVUKRXNGY-OYPDEJHISA-N |
| XLogP | 1.74 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;(4E,5E)-4-ethylidene-2-methyl-5-propylidene-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(4E,5E)-4-ethylidene-2-methyl-5-propylidene-1H-imidazole?
The IUPAC name of ethane;(4E,5E)-4-ethylidene-2-methyl-5-propylidene-1H-imidazole (CID 143453484) is ethane;(4E,5E)-4-ethylidene-2-methyl-5-propylidene-1H-imidazole.
What is the SMILES notation for ethane;(4E,5E)-4-ethylidene-2-methyl-5-propylidene-1H-imidazole?
The canonical SMILES for ethane;(4E,5E)-4-ethylidene-2-methyl-5-propylidene-1H-imidazole is C/C=c1/nc(C)[nH]/c1=C/CC.CC.
What is the InChIKey of ethane;(4E,5E)-4-ethylidene-2-methyl-5-propylidene-1H-imidazole?
The InChIKey is KGDKGSVUKRXNGY-OYPDEJHISA-N. The full InChI is InChI=1S/C9H14N2.C2H6/c1-4-6-9-8(5-2)10-7(3)11-9;1-2/h5-6H,4H2,1-3H3,(H,10,11);1-2H3/b8-5+,9-6+;.
What are the key properties of ethane;(4E,5E)-4-ethylidene-2-methyl-5-propylidene-1H-imidazole?
ethane;(4E,5E)-4-ethylidene-2-methyl-5-propylidene-1H-imidazole has a molecular weight of 180.29 g/mol, XLogP of 1.74, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(4E,5E)-4-ethylidene-2-methyl-5-propylidene-1H-imidazole is sourced from PubChem (CID 143453484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).